AsNa3O4
CAS No: 7631-89-2
76325-85-4
3,3'-(2-oxopropane-1,3-diyl)bis(1,3-dihydro-2H-indol-2-one)
7632-29-3
1,2,4-Triazine-3,5(2H,4H)-dithione, 4-methyl-
7632-76-0
2-Propene-1-thione, 1-(4-methoxyphenyl)-3-(1-piperidinyl)-
763-26-8
1,4-Butanediol, bis(dihydrogen phosphate)
763-20-2
2-methylheptane-2-thiol
76325-66-1
5-bromo-3-hydroxy-3-(2-oxopropyl)-1,3-dihydro-2H-indol-2-one
76-31-3
Cyclopentanecarboxylic acid, 3-(((3-mercapto-2-methoxypropyl)amino)carbonyl)-2,2,3-trimethyl-, mercury complex
7632-57-7
Benzene, 1,1'-(cyclopropylidenemethylene)bis-
76331-08-3
Cyclododecanone, 2-methoxy-
7632-60-2
Benzene, 1-chloro-4-(1,2-dichloroethenyl)-, (Z)-
76329-55-0
1-Hexene, 3,3-diethoxy-2-fluoro-
76315-44-1
Benzamide, N-(3-bromopropyl)-2-nitro-
7632-20-4
Isomaltotrionic acid
76326-94-8
4-(1,2-Dimethylhydrazino)thiazol-2(5H)-one
76328-97-7
1-Hexen-3-one, 2-fluoro-
76329-09-4
1-Octyn-4-ol, 4-(1-fluoroethenyl)-
76326-44-8
L-Methioninamide, L-valylglycyl-L-histidyl-L-leucyl-
76319-14-7
(3S)-3β-Amino-5β-methyltetrahydrofuran-2-one
76313-28-5
2-Propenoic acid, 2-(acetylamino)-3-(3,4-dimethoxyphenyl)-, (Z)-
7631-89-2
AsNa3O4
7631-89-2
,7631-89-2
2025-10-22 Discover AsNa3O4 (CAS No: 7631-89-2) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.